About 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one
3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one (PubChem CID 134810143) has the molecular formula C19H23N3O3
and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one.
Molecular Properties
| Compound Name | 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one |
| PubChem CID | 134810143 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one |
| SMILES | O=C1Cc2c(-c3ccc(CO)cc3)n[nH]c2CN1CC1CCOCC1 |
| InChI | InChI=1S/C19H23N3O3/c23-12-14-1-3-15(4-2-14)19-16-9-18(24)22(11-17(16)20-21-19)10-13-5-7-25-8-6-13/h1-4,13,23H,5-12H2,(H,20,21) |
| InChIKey | DAIYCDSFMUIVAN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one?
The IUPAC name of 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one (CID 134810143) is 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one.
What is the SMILES notation for 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one?
The canonical SMILES for 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one is O=C1Cc2c(-c3ccc(CO)cc3)n[nH]c2CN1CC1CCOCC1.
What is the InChIKey of 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one?
The InChIKey is DAIYCDSFMUIVAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O3/c23-12-14-1-3-15(4-2-14)19-16-9-18(24)22(11-17(16)20-21-19)10-13-5-7-25-8-6-13/h1-4,13,23H,5-12H2,(H,20,21).
What are the key properties of 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one?
3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one has a molecular weight of 341.41 g/mol, XLogP of 1.88, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(hydroxymethyl)phenyl]-6-(oxan-4-ylmethyl)-4,7-dihydro-1H-pyrazolo[5,4-c]pyridin-5-one is sourced from PubChem (CID 134810143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).