C21H26N4O2 — CID 134810201
(4aS,9aS)-7-[(2-amino-3-pyridinyl)methyl]-4-benzyl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one (PubChem CID 134810201) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is (4aS,9aS)-7-[(2-amino-3-pyridinyl)methyl]-4-benzyl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one.
| Compound Name | (4aS,9aS)-7-[(2-amino-3-pyridinyl)methyl]-4-benzyl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
|---|---|
| PubChem CID | 134810201 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (4aS,9aS)-7-[(2-amino-3-pyridinyl)methyl]-4-benzyl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
| SMILES | Nc1ncccc1CN1CC[C@@H]2OCC(=O)N(Cc3ccccc3)[C@H]2CC1 |
| InChI | InChI=1S/C21H26N4O2/c22-21-17(7-4-10-23-21)14-24-11-8-18-19(9-12-24)27-15-20(26)25(18)13-16-5-2-1-3-6-16/h1-7,10,18-19H,8-9,11-15H2,(H2,22,23)/t18-,19-/m0/s1 |
| InChIKey | JRUKVUKCNZFEHR-OALUTQOASA-N |
| XLogP | 2.06 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |