C23H24ClN3O5 — CID 134810448
3-[5-[[1-(2-chlorophenoxy)carbonylpiperidin-4-yl]methoxy]indazol-1-yl]propanoic acid (PubChem CID 134810448) has the molecular formula C23H24ClN3O5 and a molecular weight of 457.91 g/mol. Its IUPAC name is 3-[5-[[1-(2-chlorophenoxy)carbonylpiperidin-4-yl]methoxy]indazol-1-yl]propanoic acid.
| Compound Name | 3-[5-[[1-(2-chlorophenoxy)carbonylpiperidin-4-yl]methoxy]indazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 134810448 |
| Molecular Formula | C23H24ClN3O5 |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 3-[5-[[1-(2-chlorophenoxy)carbonylpiperidin-4-yl]methoxy]indazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1ncc2cc(OCC3CCN(C(=O)Oc4ccccc4Cl)CC3)ccc21 |
| InChI | InChI=1S/C23H24ClN3O5/c24-19-3-1-2-4-21(19)32-23(30)26-10-7-16(8-11-26)15-31-18-5-6-20-17(13-18)14-25-27(20)12-9-22(28)29/h1-6,13-14,16H,7-12,15H2,(H,28,29) |
| InChIKey | OPDIVEGJICUVRU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |