About CID 134810523
CID 134810523 (PubChem CID 134810523) has the molecular formula C21H20N4O3S
and a molecular weight of 408.48 g/mol.
Molecular Properties
| Compound Name | CID 134810523 |
| PubChem CID | 134810523 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | — |
| SMILES | Cn1cc(-c2ccc([S+](C)(=O)[O-])cc2)c2nc(CNc3ccccc3)cn2c1=O |
| InChI | InChI=1S/C21H20N4O3S/c1-24-14-19(15-8-10-18(11-9-15)29(2,27)28)20-23-17(13-25(20)21(24)26)12-22-16-6-4-3-5-7-16/h3-11,13-14,22H,12H2,1-2H3 |
| InChIKey | QFJSQOJDAKBYQH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 91.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 134810523 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134810523?
The IUPAC name of CID 134810523 (CID 134810523) is not available.
What is the SMILES notation for CID 134810523?
The canonical SMILES for CID 134810523 is Cn1cc(-c2ccc([S+](C)(=O)[O-])cc2)c2nc(CNc3ccccc3)cn2c1=O.
What is the InChIKey of CID 134810523?
The InChIKey is QFJSQOJDAKBYQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O3S/c1-24-14-19(15-8-10-18(11-9-15)29(2,27)28)20-23-17(13-25(20)21(24)26)12-22-16-6-4-3-5-7-16/h3-11,13-14,22H,12H2,1-2H3.
What are the key properties of CID 134810523?
CID 134810523 has a molecular weight of 408.48 g/mol, XLogP of 2.93, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134810523 is sourced from PubChem (CID 134810523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).