About 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid
4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid (PubChem CID 134810659) has the molecular formula C19H13N3O2
and a molecular weight of 315.33 g/mol. Its IUPAC name is 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid |
| PubChem CID | 134810659 |
| Molecular Formula | C19H13N3O2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ncc3cnc(-c4ccccc4)cn23)cc1 |
| InChI | InChI=1S/C19H13N3O2/c23-19(24)15-8-6-14(7-9-15)18-21-11-16-10-20-17(12-22(16)18)13-4-2-1-3-5-13/h1-12H,(H,23,24) |
| InChIKey | UQVJPNWAMVJQFK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid?
The IUPAC name of 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid (CID 134810659) is 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid.
What is the SMILES notation for 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid?
The canonical SMILES for 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid is O=C(O)c1ccc(-c2ncc3cnc(-c4ccccc4)cn23)cc1.
What is the InChIKey of 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid?
The InChIKey is UQVJPNWAMVJQFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N3O2/c23-19(24)15-8-6-14(7-9-15)18-21-11-16-10-20-17(12-22(16)18)13-4-2-1-3-5-13/h1-12H,(H,23,24).
What are the key properties of 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid?
4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid has a molecular weight of 315.33 g/mol, XLogP of 3.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-phenylimidazo[1,5-a]pyrazin-3-yl)benzoic acid is sourced from PubChem (CID 134810659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).