C20H13F2N3O — CID 134810710
1-benzyl-6-(2,4-difluorophenyl)pyrido[3,2-d]pyrimidin-4-one (PubChem CID 134810710) has the molecular formula C20H13F2N3O and a molecular weight of 349.34 g/mol. Its IUPAC name is 1-benzyl-6-(2,4-difluorophenyl)pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 1-benzyl-6-(2,4-difluorophenyl)pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 134810710 |
| Molecular Formula | C20H13F2N3O |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 1-benzyl-6-(2,4-difluorophenyl)pyrido[3,2-d]pyrimidin-4-one |
| SMILES | O=c1ncn(Cc2ccccc2)c2ccc(-c3ccc(F)cc3F)nc12 |
| InChI | InChI=1S/C20H13F2N3O/c21-14-6-7-15(16(22)10-14)17-8-9-18-19(24-17)20(26)23-12-25(18)11-13-4-2-1-3-5-13/h1-10,12H,11H2 |
| InChIKey | ZESICCRNGCIMGF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |