About 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one
3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one (PubChem CID 134810714) has the molecular formula C21H15F2N3O2
and a molecular weight of 379.37 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one |
| PubChem CID | 134810714 |
| Molecular Formula | C21H15F2N3O2 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one |
| SMILES | COCc1cccc(-c2ccc3ncn(-c4ccc(F)cc4F)c(=O)c3n2)c1 |
| InChI | InChI=1S/C21H15F2N3O2/c1-28-11-13-3-2-4-14(9-13)17-6-7-18-20(25-17)21(27)26(12-24-18)19-8-5-15(22)10-16(19)23/h2-10,12H,11H2,1H3 |
| InChIKey | QCTJKDJPFIHJFA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one?
The IUPAC name of 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one (CID 134810714) is 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one?
The canonical SMILES for 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one is COCc1cccc(-c2ccc3ncn(-c4ccc(F)cc4F)c(=O)c3n2)c1.
What is the InChIKey of 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one?
The InChIKey is QCTJKDJPFIHJFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F2N3O2/c1-28-11-13-3-2-4-14(9-13)17-6-7-18-20(25-17)21(27)26(12-24-18)19-8-5-15(22)10-16(19)23/h2-10,12H,11H2,1H3.
What are the key properties of 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one?
3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one has a molecular weight of 379.37 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-difluorophenyl)-6-[3-(methoxymethyl)phenyl]pyrido[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 134810714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).