C13H16N4O2 — CID 134811172
(3aR,6aS)-5-[(5-methyl-2-pyridinyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide (PubChem CID 134811172) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is (3aR,6aS)-5-[(5-methyl-2-pyridinyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide.
| Compound Name | (3aR,6aS)-5-[(5-methyl-2-pyridinyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
|---|---|
| PubChem CID | 134811172 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (3aR,6aS)-5-[(5-methyl-2-pyridinyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
| SMILES | Cc1ccc(CN2C[C@@H]3C(C(N)=O)=NO[C@@H]3C2)nc1 |
| InChI | InChI=1S/C13H16N4O2/c1-8-2-3-9(15-4-8)5-17-6-10-11(7-17)19-16-12(10)13(14)18/h2-4,10-11H,5-7H2,1H3,(H2,14,18)/t10-,11+/m0/s1 |
| InChIKey | UTXQKPGAULCCCY-WDEREUQCSA-N |
| XLogP | 0.06 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |