C24H29FN4O3S — CID 134811365
CID 134811365 (PubChem CID 134811365) has the molecular formula C24H29FN4O3S and a molecular weight of 472.59 g/mol.
| Compound Name | CID 134811365 |
|---|---|
| PubChem CID | 134811365 |
| Molecular Formula | C24H29FN4O3S |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])N1CCC(Cn2ccc3c(N4CCOCC4)nc(-c4ccc(F)cc4)cc32)CC1 |
| InChI | InChI=1S/C24H29FN4O3S/c1-33(30,31)29-10-6-18(7-11-29)17-28-9-8-21-23(28)16-22(19-2-4-20(25)5-3-19)26-24(21)27-12-14-32-15-13-27/h2-5,8-9,16,18H,6-7,10-15,17H2,1H3 |
| InChIKey | ZHWORGGVBJMETE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|