C20H16N2O4 — CID 134811385
6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(2-hydroxyphenyl)-2-methylisoindole-1,3-dione (PubChem CID 134811385) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(2-hydroxyphenyl)-2-methylisoindole-1,3-dione.
| Compound Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(2-hydroxyphenyl)-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 134811385 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(2-hydroxyphenyl)-2-methylisoindole-1,3-dione |
| SMILES | Cc1noc(C)c1-c1cc2c(c(-c3ccccc3O)c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C20H16N2O4/c1-10-17(11(2)26-21-10)12-8-14(13-6-4-5-7-16(13)23)18-15(9-12)19(24)22(3)20(18)25/h4-9,23H,1-3H3 |
| InChIKey | ITRURKTYNSVNPL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|