C8H18N4 — CID 134811449
3,4-dimethyl-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrazino[2,3-b]pyrazine (PubChem CID 134811449) has the molecular formula C8H18N4 and a molecular weight of 170.26 g/mol. Its IUPAC name is 3,4-dimethyl-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrazino[2,3-b]pyrazine.
| Compound Name | 3,4-dimethyl-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrazino[2,3-b]pyrazine |
|---|---|
| PubChem CID | 134811449 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 3,4-dimethyl-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrazino[2,3-b]pyrazine |
| SMILES | CC1CNC2NCCNC2N1C |
| InChI | InChI=1S/C8H18N4/c1-6-5-11-7-8(12(6)2)10-4-3-9-7/h6-11H,3-5H2,1-2H3 |
| InChIKey | AZTASMRMOGFEIU-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |