C12H24N6 — CID 134811525
2,9-dimethyl-1,4,6,8,11,13-hexazatetracyclo[6.6.2.04,16.011,15]hexadecane (PubChem CID 134811525) has the molecular formula C12H24N6 and a molecular weight of 252.37 g/mol. Its IUPAC name is 2,9-dimethyl-1,4,6,8,11,13-hexazatetracyclo[6.6.2.04,16.011,15]hexadecane.
| Compound Name | 2,9-dimethyl-1,4,6,8,11,13-hexazatetracyclo[6.6.2.04,16.011,15]hexadecane |
|---|---|
| PubChem CID | 134811525 |
| Molecular Formula | C12H24N6 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2,9-dimethyl-1,4,6,8,11,13-hexazatetracyclo[6.6.2.04,16.011,15]hexadecane |
| SMILES | CC1CN2CNCN3C(C)CN4CNCN1C4C23 |
| InChI | InChI=1S/C12H24N6/c1-9-3-15-5-14-8-18-10(2)4-16-6-13-7-17(9)11(16)12(15)18/h9-14H,3-8H2,1-2H3 |
| InChIKey | HZVOCINYYQBERS-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 37.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |