C14H13F3N2O2 — CID 134811599
ethyl 2-cyano-4,4,4-trifluoro-3-(4-methylanilino)but-2-enoate (PubChem CID 134811599) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is ethyl 2-cyano-4,4,4-trifluoro-3-(4-methylanilino)but-2-enoate.
| Compound Name | ethyl 2-cyano-4,4,4-trifluoro-3-(4-methylanilino)but-2-enoate |
|---|---|
| PubChem CID | 134811599 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | ethyl 2-cyano-4,4,4-trifluoro-3-(4-methylanilino)but-2-enoate |
| SMILES | CCOC(=O)C(C#N)=C(Nc1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O2/c1-3-21-13(20)11(8-18)12(14(15,16)17)19-10-6-4-9(2)5-7-10/h4-7,19H,3H2,1-2H3 |
| InChIKey | NYWMEPARNOGBKN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|