C14H10F6N2O2 — CID 134811690
ethyl 2-cyano-4,4,4-trifluoro-3-[2-(trifluoromethyl)anilino]but-2-enoate (PubChem CID 134811690) has the molecular formula C14H10F6N2O2 and a molecular weight of 352.23 g/mol. Its IUPAC name is ethyl 2-cyano-4,4,4-trifluoro-3-[2-(trifluoromethyl)anilino]but-2-enoate.
| Compound Name | ethyl 2-cyano-4,4,4-trifluoro-3-[2-(trifluoromethyl)anilino]but-2-enoate |
|---|---|
| PubChem CID | 134811690 |
| Molecular Formula | C14H10F6N2O2 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | ethyl 2-cyano-4,4,4-trifluoro-3-[2-(trifluoromethyl)anilino]but-2-enoate |
| SMILES | CCOC(=O)C(C#N)=C(Nc1ccccc1C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H10F6N2O2/c1-2-24-12(23)8(7-21)11(14(18,19)20)22-10-6-4-3-5-9(10)13(15,16)17/h3-6,22H,2H2,1H3 |
| InChIKey | GQSLYFFZGXZKIO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|