About 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine
6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine (PubChem CID 134811818) has the molecular formula C22H12ClFN4O2
and a molecular weight of 418.82 g/mol. Its IUPAC name is 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine.
Molecular Properties
| Compound Name | 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine |
| PubChem CID | 134811818 |
| Molecular Formula | C22H12ClFN4O2 |
| Molecular Weight | 418.82 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine |
| SMILES | O=[N+]([O-])c1ccc(-c2cnc3c(-c4ccc(F)cc4Cl)cc4cccnc4n23)cc1 |
| InChI | InChI=1S/C22H12ClFN4O2/c23-19-11-15(24)5-8-17(19)18-10-14-2-1-9-25-21(14)27-20(12-26-22(18)27)13-3-6-16(7-4-13)28(29)30/h1-12H |
| InChIKey | UOFMVDKHJMPYMM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.82 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine?
The IUPAC name of 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine (CID 134811818) is 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine.
What is the SMILES notation for 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine?
The canonical SMILES for 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine is O=[N+]([O-])c1ccc(-c2cnc3c(-c4ccc(F)cc4Cl)cc4cccnc4n23)cc1.
What is the InChIKey of 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine?
The InChIKey is UOFMVDKHJMPYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12ClFN4O2/c23-19-11-15(24)5-8-17(19)18-10-14-2-1-9-25-21(14)27-20(12-26-22(18)27)13-3-6-16(7-4-13)28(29)30/h1-12H.
What are the key properties of 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine?
6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine has a molecular weight of 418.82 g/mol, XLogP of 5.92, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-chloro-4-fluorophenyl)-9-(4-nitrophenyl)imidazo[1,2-a][1,8]naphthyridine is sourced from PubChem (CID 134811818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).