C29H19BrN2O2 — CID 134811896
4-(4-bromophenyl)-5,5-diphenylspiro[4H-pyrazole-3,2'-indene]-1',3'-dione (PubChem CID 134811896) has the molecular formula C29H19BrN2O2 and a molecular weight of 507.39 g/mol. Its IUPAC name is 4-(4-bromophenyl)-5,5-diphenylspiro[4H-pyrazole-3,2'-indene]-1',3'-dione.
| Compound Name | 4-(4-bromophenyl)-5,5-diphenylspiro[4H-pyrazole-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 134811896 |
| Molecular Formula | C29H19BrN2O2 |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | 4-(4-bromophenyl)-5,5-diphenylspiro[4H-pyrazole-3,2'-indene]-1',3'-dione |
| SMILES | O=C1c2ccccc2C(=O)C12N=NC(c1ccccc1)(c1ccccc1)C2c1ccc(Br)cc1 |
| InChI | InChI=1S/C29H19BrN2O2/c30-22-17-15-19(16-18-22)25-28(20-9-3-1-4-10-20,21-11-5-2-6-12-21)31-32-29(25)26(33)23-13-7-8-14-24(23)27(29)34/h1-18,25H |
| InChIKey | MJYFCMXEGVHDRH-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|