C13H14BNO4 — CID 134812050
6-methyl-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 134812050) has the molecular formula C13H14BNO4 and a molecular weight of 259.07 g/mol. Its IUPAC name is 6-methyl-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 6-methyl-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 134812050 |
| Molecular Formula | C13H14BNO4 |
| Molecular Weight | 259.07 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 6-methyl-2-[(E)-2-phenylethenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CN1CC(=O)OB(/C=C/c2ccccc2)OC(=O)C1 |
| InChI | InChI=1S/C13H14BNO4/c1-15-9-12(16)18-14(19-13(17)10-15)8-7-11-5-3-2-4-6-11/h2-8H,9-10H2,1H3/b8-7+ |
| InChIKey | OFLDLTAQNBBGGU-BQYQJAHWSA-N |
| XLogP | 0.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.07 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|