C26H40O6 — CID 134812177
ethyl (5R,6E,8E,10E,12R,14Z)-5,12-diacetyloxyicosa-6,8,10,14-tetraenoate (PubChem CID 134812177) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is ethyl (5R,6E,8E,10E,12R,14Z)-5,12-diacetyloxyicosa-6,8,10,14-tetraenoate.
| Compound Name | ethyl (5R,6E,8E,10E,12R,14Z)-5,12-diacetyloxyicosa-6,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 134812177 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | ethyl (5R,6E,8E,10E,12R,14Z)-5,12-diacetyloxyicosa-6,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\C[C@H](/C=C/C=C/C=C/[C@@H](CCCC(=O)OCC)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C26H40O6/c1-5-7-8-9-10-13-17-24(31-22(3)27)18-14-11-12-15-19-25(32-23(4)28)20-16-21-26(29)30-6-2/h10-15,18-19,24-25H,5-9,16-17,20-21H2,1-4H3/b12-11+,13-10-,18-14+,19-15+/t24-,25+/m1/s1 |
| InChIKey | CFOKTLVIDOPRCS-IJLSXUSBSA-N |
| XLogP | 5.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|