C27H50NO10P — CID 134812365
4-[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl]oxy-4-oxobutanoic acid (PubChem CID 134812365) has the molecular formula C27H50NO10P and a molecular weight of 579.67 g/mol. Its IUPAC name is 4-[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134812365 |
| Molecular Formula | C27H50NO10P |
| Molecular Weight | 579.67 g/mol |
| Exact Mass | 579.32 |
| IUPAC Name | 4-[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl]oxy-4-oxobutanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C27H50NO10P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26(31)35-22-24(38-27(32)19-18-25(29)30)23-37-39(33,34)36-21-20-28/h9-10,24H,2-8,11-23,28H2,1H3,(H,29,30)(H,33,34)/b10-9-/t24-/m1/s1 |
| InChIKey | HYIYHUUPCKOGSP-OPSAWKISSA-N |
| XLogP | 5.44 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.67 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|