About tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide
tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide (PubChem CID 13481248) has the molecular formula C31H32BN3O
and a molecular weight of 473.43 g/mol. Its IUPAC name is tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide.
Molecular Properties
| Compound Name | tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide |
| PubChem CID | 13481248 |
| Molecular Formula | C31H32BN3O |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide |
| SMILES | CN(C)C(=O)n1cc[n+](C)c1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C7H12N3O/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-8(2)7(11)10-5-4-9(3)6-10/h1-20H;4-6H,1-3H3/q-1;+1 |
| InChIKey | QIQPZJAXNMPWLG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide?
The IUPAC name of tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide (CID 13481248) is tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide.
What is the SMILES notation for tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide?
The canonical SMILES for tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide is CN(C)C(=O)n1cc[n+](C)c1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide?
The InChIKey is QIQPZJAXNMPWLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C7H12N3O/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-8(2)7(11)10-5-4-9(3)6-10/h1-20H;4-6H,1-3H3/q-1;+1.
What are the key properties of tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide?
tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide has a molecular weight of 473.43 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetraphenylboranuide;N,N,3-trimethylimidazol-3-ium-1-carboxamide is sourced from PubChem (CID 13481248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).