2-ethylheptyl hydrogen carbonate

C10H20O3 — CID 134812905

IUPAC2-ethylheptyl hydrogen carbonate
SMILESCCCCCC(CC)COC(=O)O
InChIInChI=1S/C10H20O3/c1-3-5-6-7-9(4-2)8-13-10(11)12/h9H,3-8H2,1-2H3,(H,11,12)
InChIKeyQTPWHCBOSIPPBS-UHFFFAOYSA-N
MW188.27 g/mol
LogP3.29
Rot. Bonds7

About 2-ethylheptyl hydrogen carbonate

2-ethylheptyl hydrogen carbonate (PubChem CID 134812905) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-ethylheptyl hydrogen carbonate.

Molecular Properties

Compound Name2-ethylheptyl hydrogen carbonate
PubChem CID134812905
Molecular FormulaC10H20O3
Molecular Weight188.27 g/mol
Exact Mass188.14
IUPAC Name2-ethylheptyl hydrogen carbonate
SMILESCCCCCC(CC)COC(=O)O
InChIInChI=1S/C10H20O3/c1-3-5-6-7-9(4-2)8-13-10(11)12/h9H,3-8H2,1-2H3,(H,11,12)
InChIKeyQTPWHCBOSIPPBS-UHFFFAOYSA-N
XLogP3.29
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.27
LogP ≤ 53.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-ethylheptyl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethylheptyl hydrogen carbonate?
The IUPAC name of 2-ethylheptyl hydrogen carbonate (CID 134812905) is 2-ethylheptyl hydrogen carbonate.
What is the SMILES notation for 2-ethylheptyl hydrogen carbonate?
The canonical SMILES for 2-ethylheptyl hydrogen carbonate is CCCCCC(CC)COC(=O)O.
What is the InChIKey of 2-ethylheptyl hydrogen carbonate?
The InChIKey is QTPWHCBOSIPPBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-3-5-6-7-9(4-2)8-13-10(11)12/h9H,3-8H2,1-2H3,(H,11,12).
What are the key properties of 2-ethylheptyl hydrogen carbonate?
2-ethylheptyl hydrogen carbonate has a molecular weight of 188.27 g/mol, XLogP of 3.29, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylheptyl hydrogen carbonate is sourced from PubChem (CID 134812905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).