C14H9N3OS — CID 134812925
2-(5-methylthieno[2,3-d]pyrimidin-6-yl)-1,3-benzoxazole (PubChem CID 134812925) has the molecular formula C14H9N3OS and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-(5-methylthieno[2,3-d]pyrimidin-6-yl)-1,3-benzoxazole.
| Compound Name | 2-(5-methylthieno[2,3-d]pyrimidin-6-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 134812925 |
| Molecular Formula | C14H9N3OS |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-(5-methylthieno[2,3-d]pyrimidin-6-yl)-1,3-benzoxazole |
| SMILES | Cc1c(-c2nc3ccccc3o2)sc2ncncc12 |
| InChI | InChI=1S/C14H9N3OS/c1-8-9-6-15-7-16-14(9)19-12(8)13-17-10-4-2-3-5-11(10)18-13/h2-7H,1H3 |
| InChIKey | MDWOAFDDVHIJPC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |