C40H36N4O2S4 — CID 134813072
(3E)-1-[5-(1,3-benzothiazol-2-ylsulfanyl)pentyl]-3-[1-[5-(1,3-benzothiazol-2-ylsulfanyl)pentyl]-2-oxoindol-3-ylidene]indol-2-one (PubChem CID 134813072) has the molecular formula C40H36N4O2S4 and a molecular weight of 733.02 g/mol. Its IUPAC name is (3E)-1-[5-(1,3-benzothiazol-2-ylsulfanyl)pentyl]-3-[1-[5-(1,3-benzothiazol-2-ylsulfanyl)pentyl]-2-oxoindol-3-ylidene]indol-2-one.
| Compound Name | (3E)-1-[5-(1,3-benzothiazol-2-ylsulfanyl)pentyl]-3-[1-[5-(1,3-benzothiazol-2-ylsulfanyl)pentyl]-2-oxoindol-3-ylidene]indol-2-one |
|---|---|
| PubChem CID | 134813072 |
| Molecular Formula | C40H36N4O2S4 |
| Molecular Weight | 733.02 g/mol |
| Exact Mass | 732.17 |
| IUPAC Name | (3E)-1-[5-(1,3-benzothiazol-2-ylsulfanyl)pentyl]-3-[1-[5-(1,3-benzothiazol-2-ylsulfanyl)pentyl]-2-oxoindol-3-ylidene]indol-2-one |
| SMILES | O=C1/C(=C2/C(=O)N(CCCCCSc3nc4ccccc4s3)c3ccccc32)c2ccccc2N1CCCCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C40H36N4O2S4/c45-37-35(27-15-3-7-19-31(27)43(37)23-11-1-13-25-47-39-41-29-17-5-9-21-33(29)49-39)36-28-16-4-8-20-32(28)44(38(36)46)24-12-2-14-26-48-40-42-30-18-6-10-22-34(30)50-40/h3-10,15-22H,1-2,11-14,23-26H2/b36-35+ |
| InChIKey | BOKGTRNICJIYND-ULDVOPSXSA-N |
| XLogP | 10.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.02 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|