C19H18N8O2 — CID 134813277
N-[4-methoxy-3-(5-methyltetrazol-1-yl)phenyl]-1-(4-methylphenyl)triazole-4-carboxamide (PubChem CID 134813277) has the molecular formula C19H18N8O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is N-[4-methoxy-3-(5-methyltetrazol-1-yl)phenyl]-1-(4-methylphenyl)triazole-4-carboxamide.
| Compound Name | N-[4-methoxy-3-(5-methyltetrazol-1-yl)phenyl]-1-(4-methylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 134813277 |
| Molecular Formula | C19H18N8O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[4-methoxy-3-(5-methyltetrazol-1-yl)phenyl]-1-(4-methylphenyl)triazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cn(-c3ccc(C)cc3)nn2)cc1-n1nnnc1C |
| InChI | InChI=1S/C19H18N8O2/c1-12-4-7-15(8-5-12)26-11-16(22-24-26)19(28)20-14-6-9-18(29-3)17(10-14)27-13(2)21-23-25-27/h4-11H,1-3H3,(H,20,28) |
| InChIKey | XUPLHNDWPFUOME-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |