C18H27F7O4Si — CID 134813806
[(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-8,8,9,9,10,10,10-heptafluorodeca-2,4-dienyl] methyl carbonate (PubChem CID 134813806) has the molecular formula C18H27F7O4Si and a molecular weight of 468.48 g/mol. Its IUPAC name is [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-8,8,9,9,10,10,10-heptafluorodeca-2,4-dienyl] methyl carbonate.
| Compound Name | [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-8,8,9,9,10,10,10-heptafluorodeca-2,4-dienyl] methyl carbonate |
|---|---|
| PubChem CID | 134813806 |
| Molecular Formula | C18H27F7O4Si |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-8,8,9,9,10,10,10-heptafluorodeca-2,4-dienyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C/C(=C/CCC(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H27F7O4Si/c1-15(2,3)30(5,6)29-13(10-8-12-28-14(26)27-4)9-7-11-16(19,20)17(21,22)18(23,24)25/h8-10H,7,11-12H2,1-6H3/b10-8+,13-9- |
| InChIKey | LBEHIEFANYQGJN-VDSCFQBISA-N |
| XLogP | 6.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|