C18H34O4Si — CID 134813807
[(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-8-methylnona-2,4-dienyl] methyl carbonate (PubChem CID 134813807) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-8-methylnona-2,4-dienyl] methyl carbonate.
| Compound Name | [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-8-methylnona-2,4-dienyl] methyl carbonate |
|---|---|
| PubChem CID | 134813807 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-8-methylnona-2,4-dienyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C/C(=C/CCC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O4Si/c1-15(2)11-9-12-16(13-10-14-21-17(19)20-6)22-23(7,8)18(3,4)5/h10,12-13,15H,9,11,14H2,1-8H3/b13-10+,16-12- |
| InChIKey | RWAFVPWZWXOSKC-AFYTUWTHSA-N |
| XLogP | 5.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|