C32H43FO5Si — CID 134813817
dibenzyl 2-[(3S,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-9-fluoronona-1,4-dien-3-yl]propanedioate (PubChem CID 134813817) has the molecular formula C32H43FO5Si and a molecular weight of 554.78 g/mol. Its IUPAC name is dibenzyl 2-[(3S,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-9-fluoronona-1,4-dien-3-yl]propanedioate.
| Compound Name | dibenzyl 2-[(3S,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-9-fluoronona-1,4-dien-3-yl]propanedioate |
|---|---|
| PubChem CID | 134813817 |
| Molecular Formula | C32H43FO5Si |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | dibenzyl 2-[(3S,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-9-fluoronona-1,4-dien-3-yl]propanedioate |
| SMILES | C=C[C@H](/C(=C/CCCCF)O[Si](C)(C)C(C)(C)C)C(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H43FO5Si/c1-7-27(28(21-15-10-16-22-33)38-39(5,6)32(2,3)4)29(30(34)36-23-25-17-11-8-12-18-25)31(35)37-24-26-19-13-9-14-20-26/h7-9,11-14,17-21,27,29H,1,10,15-16,22-24H2,2-6H3/b28-21-/t27-/m1/s1 |
| InChIKey | GJEUIYQZFZCCKF-XPEAAXJTSA-N |
| XLogP | 7.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|