C23H32F7NOSi — CID 134813823
(3S,4Z)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-8,8,9,9,10,10,10-heptafluorodeca-1,4-dien-3-amine (PubChem CID 134813823) has the molecular formula C23H32F7NOSi and a molecular weight of 499.59 g/mol. Its IUPAC name is (3S,4Z)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-8,8,9,9,10,10,10-heptafluorodeca-1,4-dien-3-amine.
| Compound Name | (3S,4Z)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-8,8,9,9,10,10,10-heptafluorodeca-1,4-dien-3-amine |
|---|---|
| PubChem CID | 134813823 |
| Molecular Formula | C23H32F7NOSi |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | (3S,4Z)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-8,8,9,9,10,10,10-heptafluorodeca-1,4-dien-3-amine |
| SMILES | C=C[C@H](NCc1ccccc1)/C(=C/CCC(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H32F7NOSi/c1-7-18(31-16-17-12-9-8-10-13-17)19(32-33(5,6)20(2,3)4)14-11-15-21(24,25)22(26,27)23(28,29)30/h7-10,12-14,18,31H,1,11,15-16H2,2-6H3/b19-14-/t18-/m0/s1 |
| InChIKey | OAVDKFQDEXJVDJ-OWBBTNHHSA-N |
| XLogP | 7.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|