About [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate
[(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate (PubChem CID 134813826) has the molecular formula C17H32O4Si
and a molecular weight of 328.53 g/mol. Its IUPAC name is [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate.
Molecular Properties
| Compound Name | [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate |
| PubChem CID | 134813826 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate |
| SMILES | CCCC/C=C(/C=C/COC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O4Si/c1-8-9-10-12-15(13-11-14-20-16(18)19-5)21-22(6,7)17(2,3)4/h11-13H,8-10,14H2,1-7H3/b13-11+,15-12- |
| InChIKey | FRTWTGHWATWHBN-DZIWGARNSA-N |
| XLogP | 5.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate?
The IUPAC name of [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate (CID 134813826) is [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate.
What is the SMILES notation for [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate?
The canonical SMILES for [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate is CCCC/C=C(/C=C/COC(=O)OC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate?
The InChIKey is FRTWTGHWATWHBN-DZIWGARNSA-N. The full InChI is InChI=1S/C17H32O4Si/c1-8-9-10-12-15(13-11-14-20-16(18)19-5)21-22(6,7)17(2,3)4/h11-13H,8-10,14H2,1-7H3/b13-11+,15-12-.
What are the key properties of [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate?
[(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate has a molecular weight of 328.53 g/mol, XLogP of 5.42, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4-dienyl] methyl carbonate is sourced from PubChem (CID 134813826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).