About methyl [(E)-4-oxonon-2-enyl] carbonate
methyl [(E)-4-oxonon-2-enyl] carbonate (PubChem CID 134813831) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is methyl [(E)-4-oxonon-2-enyl] carbonate.
Molecular Properties
| Compound Name | methyl [(E)-4-oxonon-2-enyl] carbonate |
| PubChem CID | 134813831 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | methyl [(E)-4-oxonon-2-enyl] carbonate |
| SMILES | CCCCCC(=O)/C=C/COC(=O)OC |
| InChI | InChI=1S/C11H18O4/c1-3-4-5-7-10(12)8-6-9-15-11(13)14-2/h6,8H,3-5,7,9H2,1-2H3/b8-6+ |
| InChIKey | PQMSFMMHNZNNEB-SOFGYWHQSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl [(E)-4-oxonon-2-enyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [(E)-4-oxonon-2-enyl] carbonate?
The IUPAC name of methyl [(E)-4-oxonon-2-enyl] carbonate (CID 134813831) is methyl [(E)-4-oxonon-2-enyl] carbonate.
What is the SMILES notation for methyl [(E)-4-oxonon-2-enyl] carbonate?
The canonical SMILES for methyl [(E)-4-oxonon-2-enyl] carbonate is CCCCCC(=O)/C=C/COC(=O)OC.
What is the InChIKey of methyl [(E)-4-oxonon-2-enyl] carbonate?
The InChIKey is PQMSFMMHNZNNEB-SOFGYWHQSA-N. The full InChI is InChI=1S/C11H18O4/c1-3-4-5-7-10(12)8-6-9-15-11(13)14-2/h6,8H,3-5,7,9H2,1-2H3/b8-6+.
What are the key properties of methyl [(E)-4-oxonon-2-enyl] carbonate?
methyl [(E)-4-oxonon-2-enyl] carbonate has a molecular weight of 214.26 g/mol, XLogP of 2.47, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [(E)-4-oxonon-2-enyl] carbonate is sourced from PubChem (CID 134813831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).