C22H35FOSSi — CID 134813840
tert-butyl-[(3R,4Z)-9-fluoro-3-(4-methylphenyl)sulfanylnona-1,4-dien-4-yl]oxy-dimethylsilane (PubChem CID 134813840) has the molecular formula C22H35FOSSi and a molecular weight of 394.67 g/mol. Its IUPAC name is tert-butyl-[(3R,4Z)-9-fluoro-3-(4-methylphenyl)sulfanylnona-1,4-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4Z)-9-fluoro-3-(4-methylphenyl)sulfanylnona-1,4-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134813840 |
| Molecular Formula | C22H35FOSSi |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | tert-butyl-[(3R,4Z)-9-fluoro-3-(4-methylphenyl)sulfanylnona-1,4-dien-4-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@H](Sc1ccc(C)cc1)/C(=C/CCCCF)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H35FOSSi/c1-8-21(25-19-15-13-18(2)14-16-19)20(12-10-9-11-17-23)24-26(6,7)22(3,4)5/h8,12-16,21H,1,9-11,17H2,2-7H3/b20-12-/t21-/m1/s1 |
| InChIKey | SCYVKVFKMKRKCJ-GUBQRQEFSA-N |
| XLogP | 7.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|