C12H13F7O4 — CID 134813843
[(E)-8,8,9,9,10,10,10-heptafluoro-4-oxodec-2-enyl] methyl carbonate (PubChem CID 134813843) has the molecular formula C12H13F7O4 and a molecular weight of 354.22 g/mol. Its IUPAC name is [(E)-8,8,9,9,10,10,10-heptafluoro-4-oxodec-2-enyl] methyl carbonate.
| Compound Name | [(E)-8,8,9,9,10,10,10-heptafluoro-4-oxodec-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 134813843 |
| Molecular Formula | C12H13F7O4 |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | [(E)-8,8,9,9,10,10,10-heptafluoro-4-oxodec-2-enyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C/C(=O)CCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F7O4/c1-22-9(21)23-7-3-5-8(20)4-2-6-10(13,14)11(15,16)12(17,18)19/h3,5H,2,4,6-7H2,1H3/b5-3+ |
| InChIKey | KFUISVXQQOXXCR-HWKANZROSA-N |
| XLogP | 3.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|