C19H34O6Si — CID 134813850
[(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-7-(1,3-dioxan-2-yl)hepta-2,4-dienyl] methyl carbonate (PubChem CID 134813850) has the molecular formula C19H34O6Si and a molecular weight of 386.56 g/mol. Its IUPAC name is [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-7-(1,3-dioxan-2-yl)hepta-2,4-dienyl] methyl carbonate.
| Compound Name | [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-7-(1,3-dioxan-2-yl)hepta-2,4-dienyl] methyl carbonate |
|---|---|
| PubChem CID | 134813850 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-7-(1,3-dioxan-2-yl)hepta-2,4-dienyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C/C(=C/CCC1OCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O6Si/c1-19(2,3)26(5,6)25-16(11-8-13-24-18(20)21-4)10-7-12-17-22-14-9-15-23-17/h8,10-11,17H,7,9,12-15H2,1-6H3/b11-8+,16-10- |
| InChIKey | FPHNKMZUCXBEHP-LNFYBHGTSA-N |
| XLogP | 4.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|