C24H39NO3Si — CID 134813857
(3S,4Z)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-7-(1,3-dioxan-2-yl)hepta-1,4-dien-3-amine (PubChem CID 134813857) has the molecular formula C24H39NO3Si and a molecular weight of 417.67 g/mol. Its IUPAC name is (3S,4Z)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-7-(1,3-dioxan-2-yl)hepta-1,4-dien-3-amine.
| Compound Name | (3S,4Z)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-7-(1,3-dioxan-2-yl)hepta-1,4-dien-3-amine |
|---|---|
| PubChem CID | 134813857 |
| Molecular Formula | C24H39NO3Si |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | (3S,4Z)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-7-(1,3-dioxan-2-yl)hepta-1,4-dien-3-amine |
| SMILES | C=C[C@H](NCc1ccccc1)/C(=C/CCC1OCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H39NO3Si/c1-7-21(25-19-20-13-9-8-10-14-20)22(28-29(5,6)24(2,3)4)15-11-16-23-26-17-12-18-27-23/h7-10,13-15,21,23,25H,1,11-12,16-19H2,2-6H3/b22-15-/t21-/m0/s1 |
| InChIKey | YJPRUJLPUFGJCL-FLVGQNKLSA-N |
| XLogP | 5.78 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|