About methyl [(2E)-4-oxonona-2,8-dienyl] carbonate
methyl [(2E)-4-oxonona-2,8-dienyl] carbonate (PubChem CID 134813867) has the molecular formula C11H16O4
and a molecular weight of 212.25 g/mol. Its IUPAC name is methyl [(2E)-4-oxonona-2,8-dienyl] carbonate.
Molecular Properties
| Compound Name | methyl [(2E)-4-oxonona-2,8-dienyl] carbonate |
| PubChem CID | 134813867 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | methyl [(2E)-4-oxonona-2,8-dienyl] carbonate |
| SMILES | C=CCCCC(=O)/C=C/COC(=O)OC |
| InChI | InChI=1S/C11H16O4/c1-3-4-5-7-10(12)8-6-9-15-11(13)14-2/h3,6,8H,1,4-5,7,9H2,2H3/b8-6+ |
| InChIKey | WLOXKKHZATYZIG-SOFGYWHQSA-N |
| XLogP | 2.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl [(2E)-4-oxonona-2,8-dienyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [(2E)-4-oxonona-2,8-dienyl] carbonate?
The IUPAC name of methyl [(2E)-4-oxonona-2,8-dienyl] carbonate (CID 134813867) is methyl [(2E)-4-oxonona-2,8-dienyl] carbonate.
What is the SMILES notation for methyl [(2E)-4-oxonona-2,8-dienyl] carbonate?
The canonical SMILES for methyl [(2E)-4-oxonona-2,8-dienyl] carbonate is C=CCCCC(=O)/C=C/COC(=O)OC.
What is the InChIKey of methyl [(2E)-4-oxonona-2,8-dienyl] carbonate?
The InChIKey is WLOXKKHZATYZIG-SOFGYWHQSA-N. The full InChI is InChI=1S/C11H16O4/c1-3-4-5-7-10(12)8-6-9-15-11(13)14-2/h3,6,8H,1,4-5,7,9H2,2H3/b8-6+.
What are the key properties of methyl [(2E)-4-oxonona-2,8-dienyl] carbonate?
methyl [(2E)-4-oxonona-2,8-dienyl] carbonate has a molecular weight of 212.25 g/mol, XLogP of 2.25, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [(2E)-4-oxonona-2,8-dienyl] carbonate is sourced from PubChem (CID 134813867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).