About methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate
methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate (PubChem CID 134813875) has the molecular formula C10H18O4Si
and a molecular weight of 230.34 g/mol. Its IUPAC name is methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate.
Molecular Properties
| Compound Name | methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate |
| PubChem CID | 134813875 |
| Molecular Formula | C10H18O4Si |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate |
| SMILES | C=C(/C=C/COC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C10H18O4Si/c1-9(14-15(3,4)5)7-6-8-13-10(11)12-2/h6-7H,1,8H2,2-5H3/b7-6+ |
| InChIKey | UGOIGRXDLFRQKC-VOTSOKGWSA-N |
| XLogP | 2.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate?
The IUPAC name of methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate (CID 134813875) is methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate.
What is the SMILES notation for methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate?
The canonical SMILES for methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate is C=C(/C=C/COC(=O)OC)O[Si](C)(C)C.
What is the InChIKey of methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate?
The InChIKey is UGOIGRXDLFRQKC-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H18O4Si/c1-9(14-15(3,4)5)7-6-8-13-10(11)12-2/h6-7H,1,8H2,2-5H3/b7-6+.
What are the key properties of methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate?
methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate has a molecular weight of 230.34 g/mol, XLogP of 2.69, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [(2E)-4-trimethylsilyloxypenta-2,4-dienyl] carbonate is sourced from PubChem (CID 134813875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).