C24H19N3O3 — CID 134814226
trans-(1S,2S)-N-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-2-pyridin-3-ylcyclopropane-1-carboxamide (PubChem CID 134814226) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is trans-(1S,2S)-N-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-2-pyridin-3-ylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-2-pyridin-3-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134814226 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | trans-(1S,2S)-N-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-2-pyridin-3-ylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(CN2C(=O)c3ccccc3C2=O)cc1)[C@H]1C[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C24H19N3O3/c28-22(21-12-20(21)16-4-3-11-25-13-16)26-17-9-7-15(8-10-17)14-27-23(29)18-5-1-2-6-19(18)24(27)30/h1-11,13,20-21H,12,14H2,(H,26,28)/t20-,21+/m1/s1 |
| InChIKey | ZFFWKXDUNGUFER-RTWAWAEBSA-N |
| XLogP | 3.62 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|