About methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate
methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate (PubChem CID 134814300) has the molecular formula C15H14F2N2O4
and a molecular weight of 324.28 g/mol. Its IUPAC name is methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate |
| PubChem CID | 134814300 |
| Molecular Formula | C15H14F2N2O4 |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate |
| SMILES | COC(=O)c1cn(C2CC2)c2c(OC)c(F)c(F)c(N)c2c1=O |
| InChI | InChI=1S/C15H14F2N2O4/c1-22-14-10(17)9(16)11(18)8-12(14)19(6-3-4-6)5-7(13(8)20)15(21)23-2/h5-6H,3-4,18H2,1-2H3 |
| InChIKey | QZQYQZBHMKBTIX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate?
The IUPAC name of methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate (CID 134814300) is methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate.
What is the SMILES notation for methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate?
The canonical SMILES for methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate is COC(=O)c1cn(C2CC2)c2c(OC)c(F)c(F)c(N)c2c1=O.
What is the InChIKey of methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate?
The InChIKey is QZQYQZBHMKBTIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N2O4/c1-22-14-10(17)9(16)11(18)8-12(14)19(6-3-4-6)5-7(13(8)20)15(21)23-2/h5-6H,3-4,18H2,1-2H3.
What are the key properties of methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate?
methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate has a molecular weight of 324.28 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-1-cyclopropyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate is sourced from PubChem (CID 134814300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).