C19H19NO3S — CID 134814351
(2S,5S)-10-phenyl-5-phenylsulfanyl-6,9,11-trioxa-3-azatricyclo[5.4.0.02,4]undecane (PubChem CID 134814351) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is (2S,5S)-10-phenyl-5-phenylsulfanyl-6,9,11-trioxa-3-azatricyclo[5.4.0.02,4]undecane.
| Compound Name | (2S,5S)-10-phenyl-5-phenylsulfanyl-6,9,11-trioxa-3-azatricyclo[5.4.0.02,4]undecane |
|---|---|
| PubChem CID | 134814351 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (2S,5S)-10-phenyl-5-phenylsulfanyl-6,9,11-trioxa-3-azatricyclo[5.4.0.02,4]undecane |
| SMILES | c1ccc(S[C@@H]2OC3COC(c4ccccc4)OC3[C@H]3NC32)cc1 |
| InChI | InChI=1S/C19H19NO3S/c1-3-7-12(8-4-1)18-21-11-14-17(23-18)15-16(20-15)19(22-14)24-13-9-5-2-6-10-13/h1-10,14-20H,11H2/t14?,15-,16?,17?,18?,19-/m0/s1 |
| InChIKey | BSRCFQYEJJUDIM-SLMDSZGXSA-N |
| XLogP | 2.96 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|