About 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one
4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one (PubChem CID 134814397) has the molecular formula C16H14O5
and a molecular weight of 286.28 g/mol. Its IUPAC name is 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one.
Molecular Properties
| Compound Name | 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one |
| PubChem CID | 134814397 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one |
| SMILES | COc1cccc2c1C(=O)OCc1cc(C)cc(O)c1O2 |
| InChI | InChI=1S/C16H14O5/c1-9-6-10-8-20-16(18)14-12(19-2)4-3-5-13(14)21-15(10)11(17)7-9/h3-7,17H,8H2,1-2H3 |
| InChIKey | IVDTVTYLOZSMTC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one?
The IUPAC name of 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one (CID 134814397) is 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one.
What is the SMILES notation for 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one?
The canonical SMILES for 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one is COc1cccc2c1C(=O)OCc1cc(C)cc(O)c1O2.
What is the InChIKey of 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one?
The InChIKey is IVDTVTYLOZSMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O5/c1-9-6-10-8-20-16(18)14-12(19-2)4-3-5-13(14)21-15(10)11(17)7-9/h3-7,17H,8H2,1-2H3.
What are the key properties of 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one?
4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one has a molecular weight of 286.28 g/mol, XLogP of 3.17, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-9-methoxy-2-methyl-12H-benzo[b][1,5]benzodioxocin-10-one is sourced from PubChem (CID 134814397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).