About disodium;phosphonatoformate
disodium;phosphonatoformate (PubChem CID 134814447) has the molecular formula CNa2O5P-
and a molecular weight of 168.96 g/mol. Its IUPAC name is disodium;phosphonatoformate.
Molecular Properties
| Compound Name | disodium;phosphonatoformate |
| PubChem CID | 134814447 |
| Molecular Formula | CNa2O5P- |
| Molecular Weight | 168.96 g/mol |
| Exact Mass | 168.93 |
| IUPAC Name | disodium;phosphonatoformate |
| SMILES | O=C([O-])P(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/CH3O5P.2Na/c2-1(3)7(4,5)6;;/h(H,2,3)(H2,4,5,6);;/q;2*+1/p-3 |
| InChIKey | NBIIDLGNZMCRLU-UHFFFAOYSA-K |
| XLogP | -8.75 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.96 |
| LogP ≤ 5 | -8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;phosphonatoformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;phosphonatoformate?
The IUPAC name of disodium;phosphonatoformate (CID 134814447) is disodium;phosphonatoformate.
What is the SMILES notation for disodium;phosphonatoformate?
The canonical SMILES for disodium;phosphonatoformate is O=C([O-])P(=O)([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;phosphonatoformate?
The InChIKey is NBIIDLGNZMCRLU-UHFFFAOYSA-K. The full InChI is InChI=1S/CH3O5P.2Na/c2-1(3)7(4,5)6;;/h(H,2,3)(H2,4,5,6);;/q;2*+1/p-3.
What are the key properties of disodium;phosphonatoformate?
disodium;phosphonatoformate has a molecular weight of 168.96 g/mol, XLogP of -8.75, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;phosphonatoformate is sourced from PubChem (CID 134814447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).