C39H49N5O7S — CID 134814634
prop-2-enyl (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]pentanoate (PubChem CID 134814634) has the molecular formula C39H49N5O7S and a molecular weight of 731.92 g/mol. Its IUPAC name is prop-2-enyl (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]pentanoate.
| Compound Name | prop-2-enyl (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]pentanoate |
|---|---|
| PubChem CID | 134814634 |
| Molecular Formula | C39H49N5O7S |
| Molecular Weight | 731.92 g/mol |
| Exact Mass | 731.34 |
| IUPAC Name | prop-2-enyl (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]pentanoate |
| SMILES | C=CCOC(=O)[C@H](CCC/N=C(\N)NS(=O)(=O)c1c(C)c(C)c2c(c1C)CC(C)(C)O2)NCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C39H49N5O7S/c1-7-21-49-36(45)33(41-19-20-43-38(46)50-23-32-29-15-10-8-13-27(29)28-14-9-11-16-30(28)32)17-12-18-42-37(40)44-52(47,48)35-25(3)24(2)34-31(26(35)4)22-39(5,6)51-34/h7-11,13-16,32-33,41H,1,12,17-23H2,2-6H3,(H,43,46)(H3,40,42,44)/t33-/m0/s1 |
| InChIKey | YNKZPEKCXHLEDE-XIFFEERXSA-N |
| XLogP | 4.92 |
| TPSA | 170.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.92 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|