C22H28Cl2Zr — CID 134814661
2-tert-butyl-5-propan-2-ylcyclopenta-1,3-diene;dichlorozirconium(2+);3-methyl-2,5-dihydroinden-2-ide (PubChem CID 134814661) has the molecular formula C22H28Cl2Zr and a molecular weight of 454.60 g/mol. Its IUPAC name is 2-tert-butyl-5-propan-2-ylcyclopenta-1,3-diene;dichlorozirconium(2+);3-methyl-2,5-dihydroinden-2-ide.
| Compound Name | 2-tert-butyl-5-propan-2-ylcyclopenta-1,3-diene;dichlorozirconium(2+);3-methyl-2,5-dihydroinden-2-ide |
|---|---|
| PubChem CID | 134814661 |
| Molecular Formula | C22H28Cl2Zr |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 2-tert-butyl-5-propan-2-ylcyclopenta-1,3-diene;dichlorozirconium(2+);3-methyl-2,5-dihydroinden-2-ide |
| SMILES | CC1=[C-]C=C2C=CCC=C12.C[C-](C)C1C=CC(C(C)(C)C)=C1.Cl[Zr+2]Cl |
| InChI | InChI=1S/C12H19.C10H9.2ClH.Zr/c1-9(2)10-6-7-11(8-10)12(3,4)5;1-8-6-7-9-4-2-3-5-10(8)9;;;/h6-8,10H,1-5H3;2,4-5,7H,3H2,1H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | VHNSCDHLWKLQKV-UHFFFAOYSA-L |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|