C20H32O — CID 134814701
2-[(2S,4aR,4bS,8aS,10aR)-2,4a,8a-trimethyl-8-methylidene-1,3,4,4b,5,6,7,9,10,10a-decahydrophenanthren-2-yl]oxirane (PubChem CID 134814701) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 2-[(2S,4aR,4bS,8aS,10aR)-2,4a,8a-trimethyl-8-methylidene-1,3,4,4b,5,6,7,9,10,10a-decahydrophenanthren-2-yl]oxirane.
| Compound Name | 2-[(2S,4aR,4bS,8aS,10aR)-2,4a,8a-trimethyl-8-methylidene-1,3,4,4b,5,6,7,9,10,10a-decahydrophenanthren-2-yl]oxirane |
|---|---|
| PubChem CID | 134814701 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 2-[(2S,4aR,4bS,8aS,10aR)-2,4a,8a-trimethyl-8-methylidene-1,3,4,4b,5,6,7,9,10,10a-decahydrophenanthren-2-yl]oxirane |
| SMILES | C=C1CCC[C@H]2[C@]3(C)CC[C@](C)(C4CO4)C[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H32O/c1-14-6-5-7-16-19(14,3)9-8-15-12-18(2,17-13-21-17)10-11-20(15,16)4/h15-17H,1,5-13H2,2-4H3/t15-,16-,17?,18+,19-,20-/m1/s1 |
| InChIKey | MDUIQYUVECBDRX-LBNFNQNDSA-N |
| XLogP | 5.35 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|