C17H23BN4O7 — CID 134815185
[[(2S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]methylboronic acid (PubChem CID 134815185) has the molecular formula C17H23BN4O7 and a molecular weight of 406.20 g/mol. Its IUPAC name is [[(2S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]methylboronic acid.
| Compound Name | [[(2S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]methylboronic acid |
|---|---|
| PubChem CID | 134815185 |
| Molecular Formula | C17H23BN4O7 |
| Molecular Weight | 406.20 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | [[(2S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]methylboronic acid |
| SMILES | CCN1CCN(C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)NCB(O)O)C(=O)C1=O |
| InChI | InChI=1S/C17H23BN4O7/c1-2-21-7-8-22(16(26)15(21)25)17(27)20-13(14(24)19-10-18(28)29)9-11-3-5-12(23)6-4-11/h3-6,13,23,28-29H,2,7-10H2,1H3,(H,19,24)(H,20,27)/t13-/m0/s1 |
| InChIKey | INXKLMQPFNYGIK-ZDUSSCGKSA-N |
| XLogP | -2.17 |
| TPSA | 159.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.20 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|