C31H50O2 — CID 134815278
[(3S,6aR,8aS,12aR,14bR)-4,4,6a,8a,11,11,14b-heptamethyl-2,3,4a,5,6,6b,7,8,9,10,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate (PubChem CID 134815278) has the molecular formula C31H50O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is [(3S,6aR,8aS,12aR,14bR)-4,4,6a,8a,11,11,14b-heptamethyl-2,3,4a,5,6,6b,7,8,9,10,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate.
| Compound Name | [(3S,6aR,8aS,12aR,14bR)-4,4,6a,8a,11,11,14b-heptamethyl-2,3,4a,5,6,6b,7,8,9,10,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate |
|---|---|
| PubChem CID | 134815278 |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | [(3S,6aR,8aS,12aR,14bR)-4,4,6a,8a,11,11,14b-heptamethyl-2,3,4a,5,6,6b,7,8,9,10,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(CC[C@@]3(C)C4CC[C@@]5(C)CCC(C)(C)C[C@H]5C4=CCC32)C1(C)C |
| InChI | InChI=1S/C31H50O2/c1-20(32)33-26-13-16-31(8)24(28(26,4)5)12-15-30(7)22-11-14-29(6)18-17-27(2,3)19-23(29)21(22)9-10-25(30)31/h9,22-26H,10-19H2,1-8H3/t22?,23-,24?,25?,26-,29-,30-,31-/m0/s1 |
| InChIKey | NRWGSQKSIOQTPX-XEWMJFFBSA-N |
| XLogP | 8.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|