About N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine
N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine (PubChem CID 134815487) has the molecular formula C14H8Cl2F3N5
and a molecular weight of 374.15 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine.
Molecular Properties
| Compound Name | N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine |
| PubChem CID | 134815487 |
| Molecular Formula | C14H8Cl2F3N5 |
| Molecular Weight | 374.15 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine |
| SMILES | FC(F)(F)c1cccc(-n2nnnc2Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H8Cl2F3N5/c15-11-5-4-9(7-12(11)16)20-13-21-22-23-24(13)10-3-1-2-8(6-10)14(17,18)19/h1-7H,(H,20,21,23) |
| InChIKey | NDPSVAFAJHQMRQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.15 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine?
The IUPAC name of N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine (CID 134815487) is N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine.
What is the SMILES notation for N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine?
The canonical SMILES for N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine is FC(F)(F)c1cccc(-n2nnnc2Nc2ccc(Cl)c(Cl)c2)c1.
What is the InChIKey of N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine?
The InChIKey is NDPSVAFAJHQMRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2F3N5/c15-11-5-4-9(7-12(11)16)20-13-21-22-23-24(13)10-3-1-2-8(6-10)14(17,18)19/h1-7H,(H,20,21,23).
What are the key properties of N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine?
N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine has a molecular weight of 374.15 g/mol, XLogP of 4.73, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dichlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine is sourced from PubChem (CID 134815487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).