About cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate
cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate (PubChem CID 134815503) has the molecular formula C18H18O7S
and a molecular weight of 378.40 g/mol. Its IUPAC name is cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate.
Molecular Properties
| Compound Name | cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate |
| PubChem CID | 134815503 |
| Molecular Formula | C18H18O7S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate |
| SMILES | COc1c2ccoc2c(S(=O)(=O)OC2CCCC2)c2oc(C)cc(=O)c12 |
| InChI | InChI=1S/C18H18O7S/c1-10-9-13(19)14-15(22-2)12-7-8-23-16(12)18(17(14)24-10)26(20,21)25-11-5-3-4-6-11/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | ANHCBMFDKMYETH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 95.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate?
The IUPAC name of cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate (CID 134815503) is cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate.
What is the SMILES notation for cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate?
The canonical SMILES for cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate is COc1c2ccoc2c(S(=O)(=O)OC2CCCC2)c2oc(C)cc(=O)c12.
What is the InChIKey of cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate?
The InChIKey is ANHCBMFDKMYETH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O7S/c1-10-9-13(19)14-15(22-2)12-7-8-23-16(12)18(17(14)24-10)26(20,21)25-11-5-3-4-6-11/h7-9,11H,3-6H2,1-2H3.
What are the key properties of cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate?
cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate has a molecular weight of 378.40 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl 4-methoxy-7-methyl-5-oxofuro[3,2-g]chromene-9-sulfonate is sourced from PubChem (CID 134815503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).