C27H42F3N3O — CID 134815621
N-[4-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]butyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 134815621) has the molecular formula C27H42F3N3O and a molecular weight of 481.65 g/mol. Its IUPAC name is N-[4-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]butyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[4-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]butyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 134815621 |
| Molecular Formula | C27H42F3N3O |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | N-[4-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]butyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCCCCN1CCCC2=C[C@H]3C[C@H](CN4CCCC[C@H]34)[C@@H]21)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C27H42F3N3O/c28-27(29,30)23-10-8-19(9-11-23)26(34)31-12-2-4-13-32-15-5-6-20-16-21-17-22(25(20)32)18-33-14-3-1-7-24(21)33/h16,19,21-25H,1-15,17-18H2,(H,31,34)/t19?,21-,22+,23?,24+,25+/m0/s1 |
| InChIKey | ZVPWVFUETFFESI-OTZNAKSLSA-N |
| XLogP | 5.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|