C30H39N3OS — CID 134815644
N-[4-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]butyl]-4-thiophen-2-ylbenzamide (PubChem CID 134815644) has the molecular formula C30H39N3OS and a molecular weight of 489.73 g/mol. Its IUPAC name is N-[4-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]butyl]-4-thiophen-2-ylbenzamide.
| Compound Name | N-[4-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]butyl]-4-thiophen-2-ylbenzamide |
|---|---|
| PubChem CID | 134815644 |
| Molecular Formula | C30H39N3OS |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | N-[4-[(1R,2S,9R,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]butyl]-4-thiophen-2-ylbenzamide |
| SMILES | O=C(NCCCCN1CCCC2=C[C@H]3C[C@H](CN4CCCC[C@H]34)[C@@H]21)c1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C30H39N3OS/c34-30(23-12-10-22(11-13-23)28-9-6-18-35-28)31-14-2-4-15-32-17-5-7-24-19-25-20-26(29(24)32)21-33-16-3-1-8-27(25)33/h6,9-13,18-19,25-27,29H,1-5,7-8,14-17,20-21H2,(H,31,34)/t25-,26+,27+,29+/m0/s1 |
| InChIKey | OWAASSZLHPRPMY-NFWVVERESA-N |
| XLogP | 5.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|